ChemNet > CAS > 556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
| Ürün Adı |
1,4-Cyclohexanediol, mixture of cis and trans |
| Eş anlamlı |
Cyclohexanediolcistrans; 1,4-Cyclohexanediol; Hexahydrohydroquinone; 1,4-Hexandiol; Quinitol; 1,4-Bis(hydroxymethyl)-cyclohexane; cyclohexane-1,4-diol; trans-cyclohexane-1,4-diol; 1,4-Cyclohexanediol (cis & trans mixture) |
| Moleküler Formülü |
C6H12O2 |
| Molekül Ağırlığı |
116.1583 |
| InChI |
InChI=1/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/t5-,6- |
| CAS kayıt numarası |
556-48-9 |
| EINECS |
209-126-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.156g/cm3 |
| Ergime noktası |
98-100℃ |
| Kaynama noktası |
252.4°C at 760 mmHg |
| Kırılma indisi |
1.526 |
| Alevlenme noktası |
65.6°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:;
|
|
