ChemNet > CAS > 55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
| Ürün Adı |
2,6-Dimethoxy-3-nitrobenzoic acid |
| Moleküler Formülü |
C9H9NO6 |
| Molekül Ağırlığı |
227.1709 |
| InChI |
InChI=1/C9H9NO6/c1-15-6-4-3-5(10(13)14)8(16-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
| CAS kayıt numarası |
55776-17-5 |
| EINECS |
259-814-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.403g/cm3 |
| Kaynama noktası |
420.7°C at 760 mmHg |
| Kırılma indisi |
1.569 |
| Alevlenme noktası |
208.2°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
