ChemNet > CAS > 565-60-6 3-Methyl-2-pentanol
565-60-6 3-Methyl-2-pentanol
| Ürün Adı |
3-Methyl-2-pentanol |
| Eş anlamlı |
2-pentanol, 3-methyl-; 3-Methylpentan-2-ol; Threo-3-methylpentan-2-ol; (2R,3R)-3-methylpentan-2-ol; (2R,3S)-3-methylpentan-2-ol; (2S,3R)-3-methylpentan-2-ol; (2S,3S)-3-methylpentan-2-ol |
| Moleküler Formülü |
C6H14O |
| Molekül Ağırlığı |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3/t5-,6-/m0/s1 |
| CAS kayıt numarası |
565-60-6 |
| EINECS |
209-281-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.811g/cm3 |
| Kaynama noktası |
133.5°C at 760 mmHg |
| Kırılma indisi |
1.411 |
| Alevlenme noktası |
40.6°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R10:Flammable.;
R37:Irritating to respiratory system.;
|
| Güvenlik Açıklaması |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|
