ChemNet > CAS > 5678-48-8 3-Amino-3-(2-nitrophenyl)propionic acid
5678-48-8 3-Amino-3-(2-nitrophenyl)propionic acid
| Ürün Adı |
3-Amino-3-(2-nitrophenyl)propionic acid |
| Eş anlamlı |
3-Amino-3-(2-nitrophenyl)propanoic acid; (3R)-3-amino-3-(2-nitrophenyl)propanoic acid; (3S)-3-ammonio-3-(2-nitrophenyl)propanoate |
| Moleküler Formülü |
C9H10N2O4 |
| Molekül Ağırlığı |
210.1867 |
| InChI |
InChI=1/C9H10N2O4/c10-7(5-9(12)13)6-3-1-2-4-8(6)11(14)15/h1-4,7H,5,10H2,(H,12,13)/t7-/m0/s1 |
| CAS kayıt numarası |
5678-48-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.404g/cm3 |
| Ergime noktası |
218℃ |
| Kaynama noktası |
423.8°C at 760 mmHg |
| Kırılma indisi |
1.612 |
| Alevlenme noktası |
210.1°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
