ChemNet > CAS > 589-62-8 4-octanol
589-62-8 4-octanol
Ürün Adı |
4-octanol |
Eş anlamlı |
n-Butyl n-propyl carbinol; octan-4-ol |
Moleküler Formülü |
C8H18O |
Molekül Ağırlığı |
130.2279 |
InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
CAS kayıt numarası |
589-62-8 |
EINECS |
209-654-3 |
Moleküler Yapısı |
|
Yoğunluk |
0.821g/cm3 |
Kaynama noktası |
179.2°C at 760 mmHg |
Kırılma indisi |
1.426 |
Alevlenme noktası |
71.1°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|