ChemNet > CAS > 5905-69-1 4-(difluoromethoxy)bromobenzene
5905-69-1 4-(difluoromethoxy)bromobenzene
| Ürün Adı |
4-(difluoromethoxy)bromobenzene |
| Eş anlamlı |
1-Bromo-4-(difluoromethoxy)benzene; p-Difluoromethoxybromobenzene |
| Moleküler Formülü |
C7H5BrF2O |
| Molekül Ağırlığı |
223.0148 |
| InChI |
InChI=1/C7H5BrF2O/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4,7H |
| CAS kayıt numarası |
5905-69-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.583g/cm3 |
| Kaynama noktası |
205.406°C at 760 mmHg |
| Kırılma indisi |
1.492 |
| Alevlenme noktası |
92.591°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
