ChemNet > CAS > 591-23-1 3-Methylcyclohexanol, mixture of cis and trans
591-23-1 3-Methylcyclohexanol, mixture of cis and trans
| Ürün Adı |
3-Methylcyclohexanol, mixture of cis and trans |
| Eş anlamlı |
3-Methylcyclohexanol (cis+trans); 3-Methylcyclohexanol; (1S,3R)-3-methylcyclohexanol; (1R,3R)-3-methylcyclohexanol; (1S,3S)-3-methylcyclohexanol |
| Moleküler Formülü |
C7H14O |
| Molekül Ağırlığı |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-6-3-2-4-7(8)5-6/h6-8H,2-5H2,1H3/t6-,7-/m0/s1 |
| CAS kayıt numarası |
591-23-1 |
| EINECS |
209-709-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.925g/cm3 |
| Ergime noktası |
-74℃ |
| Kaynama noktası |
170.3°C at 760 mmHg |
| Kırılma indisi |
1.462 |
| Alevlenme noktası |
62.8°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
