ChemNet > CAS > 6138-90-5 Geranyl Bromide
6138-90-5 Geranyl Bromide
Ürün Adı |
Geranyl Bromide |
Eş anlamlı |
3,7-Dimethyl-2,6-octadienyl bromide; 3,7-Dimethyl-2,6-octadienyl bromide; (2E)-1-bromo-3,7-dimethylocta-2,6-diene |
Moleküler Formülü |
C10H17Br |
Molekül Ağırlığı |
217.146 |
InChI |
InChI=1/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
CAS kayıt numarası |
6138-90-5 |
EINECS |
228-123-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.121g/cm3 |
Kaynama noktası |
227.7°C at 760 mmHg |
Kırılma indisi |
1.489 |
Alevlenme noktası |
95°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|