ChemNet > CAS > 62306-79-0 5-Methylfuran-2-boronic acid
62306-79-0 5-Methylfuran-2-boronic acid
| Ürün Adı |
5-Methylfuran-2-boronic acid |
| Eş anlamlı |
(5-Methyl-2-furanyl)-boronic acid; 5-Methylfuryl-2-boronic acid; (5-methyl-2-furyl)boronic acid |
| Moleküler Formülü |
C5H7BO3 |
| Molekül Ağırlığı |
125.9183 |
| InChI |
InChI=1/C5H7BO3/c1-4-2-3-5(9-4)6(7)8/h2-3,7-8H,1H3 |
| CAS kayıt numarası |
62306-79-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.197g/cm3 |
| Kaynama noktası |
264.365°C at 760 mmHg |
| Kırılma indisi |
1.489 |
| Alevlenme noktası |
113.684°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
