ChemNet > CAS > 625-48-9 2-Nitroethanol
625-48-9 2-Nitroethanol
Ürün Adı |
2-Nitroethanol |
Eş anlamlı |
1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
Moleküler Formülü |
C2H5NO3 |
Molekül Ağırlığı |
91.07 |
InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
CAS kayıt numarası |
625-48-9 |
EINECS |
210-895-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.267g/cm3 |
Kaynama noktası |
193.8°C at 760 mmHg |
Kırılma indisi |
1.438 |
Alevlenme noktası |
113.8°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|