ChemNet > CAS > 6318-56-5 5-aminobenzene-1,3-diol hydrochloride
6318-56-5 5-aminobenzene-1,3-diol hydrochloride
| Ürün Adı |
5-aminobenzene-1,3-diol hydrochloride |
| Eş anlamlı |
5-aminobenzene-1,3-diol; 5-aminobenzene-1,3-diol hydrochloride (1:1) |
| Moleküler Formülü |
C6H8ClNO2 |
| Molekül Ağırlığı |
161.5862 |
| InChI |
InChI=1/C6H7NO2.ClH/c7-4-1-5(8)3-6(9)2-4;/h1-3,8-9H,7H2;1H |
| CAS kayıt numarası |
6318-56-5 |
| Moleküler Yapısı |
|
| Ergime noktası |
182℃ |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
