ChemNet > CAS > 63417-81-2 5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole
63417-81-2 5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole
Ürün Adı |
5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole |
Eş anlamlı |
5-(chloromethyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole |
Moleküler Formülü |
C7H5ClN2OS |
Molekül Ağırlığı |
200.6454 |
InChI |
InChI=1/C7H5ClN2OS/c8-4-6-9-7(10-11-6)5-2-1-3-12-5/h1-3H,4H2 |
CAS kayıt numarası |
63417-81-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.421g/cm3 |
Ergime noktası |
59℃ |
Kaynama noktası |
331.3°C at 760 mmHg |
Kırılma indisi |
1.587 |
Alevlenme noktası |
154.1°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|