ChemNet > CAS > 64218-50-4 2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one
64218-50-4 2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one
Ürün Adı |
2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one |
Eş anlamlı |
2-chloro-1-(4,5-dichlorothiophen-2-yl)ethanone |
Moleküler Formülü |
C6H3Cl3OS |
Molekül Ağırlığı |
229.5114 |
InChI |
InChI=1/C6H3Cl3OS/c7-2-4(10)5-1-3(8)6(9)11-5/h1H,2H2 |
CAS kayıt numarası |
64218-50-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.574g/cm3 |
Ergime noktası |
56℃ |
Kaynama noktası |
355.8°C at 760 mmHg |
Kırılma indisi |
1.591 |
Alevlenme noktası |
169°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|