ChemNet > CAS > 64218-50-4 2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one
64218-50-4 2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one
| Ürün Adı |
2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one |
| Eş anlamlı |
2-chloro-1-(4,5-dichlorothiophen-2-yl)ethanone |
| Moleküler Formülü |
C6H3Cl3OS |
| Molekül Ağırlığı |
229.5114 |
| InChI |
InChI=1/C6H3Cl3OS/c7-2-4(10)5-1-3(8)6(9)11-5/h1H,2H2 |
| CAS kayıt numarası |
64218-50-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.574g/cm3 |
| Ergime noktası |
56℃ |
| Kaynama noktası |
355.8°C at 760 mmHg |
| Kırılma indisi |
1.591 |
| Alevlenme noktası |
169°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
