ChemNet > CAS > 64415-11-8 4,6-Dichloro-2-methylthio-5-phenylpyrimidine
64415-11-8 4,6-Dichloro-2-methylthio-5-phenylpyrimidine
Ürün Adı |
4,6-Dichloro-2-methylthio-5-phenylpyrimidine |
Eş anlamlı |
4,6-dichloro-2-(methylsulfanyl)-5-phenylpyrimidine |
Moleküler Formülü |
C11H8Cl2N2S |
Molekül Ağırlığı |
271.1656 |
InChI |
InChI=1/C11H8Cl2N2S/c1-16-11-14-9(12)8(10(13)15-11)7-5-3-2-4-6-7/h2-6H,1H3 |
CAS kayıt numarası |
64415-11-8 |
EINECS |
264-877-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.43g/cm3 |
Ergime noktası |
107-111℃ |
Kaynama noktası |
364.3°C at 760 mmHg |
Kırılma indisi |
1.657 |
Alevlenme noktası |
174.1°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
|
|