ChemNet > CAS > 652-32-4 2,3,5,6-Tetrafluoro-p-toluic acid
652-32-4 2,3,5,6-Tetrafluoro-p-toluic acid
Ürün Adı |
2,3,5,6-Tetrafluoro-p-toluic acid |
Eş anlamlı |
2,3,5,6-Tetrafluoro-4-methylbenzoic acid; 2,3,5,6-tetrafluoro-4-methylbenzoate |
Moleküler Formülü |
C8H3F4O2 |
Molekül Ağırlığı |
207.1024 |
InChI |
InChI=1/C8H4F4O2/c1-2-4(9)6(11)3(8(13)14)7(12)5(2)10/h1H3,(H,13,14)/p-1 |
CAS kayıt numarası |
652-32-4 |
Moleküler Yapısı |
|
Ergime noktası |
168-175℃ |
Kaynama noktası |
255.8°C at 760 mmHg |
Alevlenme noktası |
108.5°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|