ChemNet > CAS > 656-42-8 2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde
656-42-8 2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde
Ürün Adı |
2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde |
Eş anlamlı |
2,2-Difluoro-5-formyl-1,3-benzodioxole; 2,2-difluoro-1,3-benzodioxole-5-carbaldehyde; 2,2-Difluorobenzodioxole-5-Carboxaldehyde |
Moleküler Formülü |
C8H4F2O3 |
Molekül Ağırlığı |
186.1124 |
InChI |
InChI=1/C8H4F2O3/c9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-4H |
CAS kayıt numarası |
656-42-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.5g/cm3 |
Kaynama noktası |
210.5°C at 760 mmHg |
Kırılma indisi |
1.525 |
Alevlenme noktası |
79.1°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|