ChemNet > CAS > 65651-80-1;53927-12-1 Ethyl trans-3-(1-pyrrolidino)acrylate
65651-80-1;53927-12-1 Ethyl trans-3-(1-pyrrolidino)acrylate
| Ürün Adı |
Ethyl trans-3-(1-pyrrolidino)acrylate |
| Eş anlamlı |
Ethyl trans-3-(1-pyrrolidino)propenoate; Ethyl3-(1-pyrrolidinyl)acrylate; ethyl (2E)-3-(pyrrolidin-1-yl)prop-2-enoate |
| Moleküler Formülü |
C9H15NO2 |
| Molekül Ağırlığı |
169.2209 |
| InChI |
InChI=1/C9H15NO2/c1-2-12-9(11)5-8-10-6-3-4-7-10/h5,8H,2-4,6-7H2,1H3/b8-5+ |
| CAS kayıt numarası |
65651-80-1;53927-12-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.112g/cm3 |
| Kaynama noktası |
245.9°C at 760 mmHg |
| Kırılma indisi |
1.554 |
| Alevlenme noktası |
95.9°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
