ChemNet > CAS > 659-30-3 4-fluorophenylurea
659-30-3 4-fluorophenylurea
Ürün Adı |
4-fluorophenylurea |
Eş anlamlı |
Urea, 1-(p-fluorophenyl)-; (4-Fluorophenyl)urea; 1-(p-Fluorophenyl)urea; 4-12-00-01108 (Beilstein Handbook Reference); BRN 2090131; 1-(4-fluorophenyl)urea; 1-(4-fluorophenyl)-1H-pyrrole |
Moleküler Formülü |
C10H8FN |
Molekül Ağırlığı |
161.1756 |
InChI |
InChI=1/C10H8FN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H |
CAS kayıt numarası |
659-30-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.07g/cm3 |
Kaynama noktası |
229.7°C at 760 mmHg |
Kırılma indisi |
1.543 |
Alevlenme noktası |
92.7°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|