ChemNet > CAS > 6640-24-0 1-(3-Chlorophenyl)piperazine
6640-24-0 1-(3-Chlorophenyl)piperazine
Ürün Adı |
1-(3-Chlorophenyl)piperazine |
Eş anlamlı |
3-Chlorphenylpiperazine; 1-(3-Chlorphenyl)-piperazine; 3-Chlorophenyl piperazine; 1-(3-Chlorophenyl)-piperazine |
Moleküler Formülü |
C10H13ClN2 |
Molekül Ağırlığı |
196.6766 |
InChI |
InChI=1/C10H13ClN2/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2 |
CAS kayıt numarası |
6640-24-0 |
EINECS |
229-654-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.159g/cm3 |
Ergime noktası |
210-214℃ |
Kaynama noktası |
336.4°C at 760 mmHg |
Kırılma indisi |
1.557 |
Alevlenme noktası |
157.2°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|