ChemNet > CAS > 67442-07-3 2-Chloro-N-methoxy-N-methylacetamide
67442-07-3 2-Chloro-N-methoxy-N-methylacetamide
Ürün Adı |
2-Chloro-N-methoxy-N-methylacetamide |
Eş anlamlı |
Acetamide, 2-chloro-N-methoxy-N-methyl-; N-Methyl-N-methoxy-2-chloroacetamide |
Moleküler Formülü |
C4H8ClNO2 |
Molekül Ağırlığı |
137.5648 |
InChI |
InChI=1/C4H8ClNO2/c1-6(8-2)4(7)3-5/h3H2,1-2H3 |
CAS kayıt numarası |
67442-07-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.178g/cm3 |
Ergime noktası |
39-41℃ |
Kaynama noktası |
141.5°C at 760 mmHg |
Kırılma indisi |
1.442 |
Alevlenme noktası |
39.4°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|