ChemNet > CAS > 67751-23-9 4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one
67751-23-9 4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one
| Ürün Adı |
4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one |
| Eş anlamlı |
(3E)-4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one; (3Z)-4-(dimethylamino)-1,1-dimethoxybut-3-en-2-one; 1,1-Dimethoxy-4-dimethylaminobut-3-en-2-one; (Z)-4-(Dimethylamino)-1,1-dimethoxybut-3-en-2-one |
| Moleküler Formülü |
C8H15NO3 |
| Molekül Ağırlığı |
173.2096 |
| InChI |
InChI=1/C8H15NO3/c1-9(2)6-5-7(10)8(11-3)12-4/h5-6,8H,1-4H3/b6-5- |
| CAS kayıt numarası |
67751-23-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.009g/cm3 |
| Kaynama noktası |
211.238°C at 760 mmHg |
| Kırılma indisi |
1.453 |
| Alevlenme noktası |
81.554°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
