ChemNet > CAS > 6843-49-8 5-Methyl-5-phenylhydantoin
6843-49-8 5-Methyl-5-phenylhydantoin
| Ürün Adı |
5-Methyl-5-phenylhydantoin |
| Eş anlamlı |
AI3-03732; T13; 2,4-Imidazolidinedione, 5-methyl-5-phenyl- (9CI); 5-Methyl-5-phenylimidazolidine-2,4-dione; Hydantoin, 5-methyl-5-phenyl-; (5S)-5-methyl-5-phenylimidazolidine-2,4-dione; (5R)-5-cyclohexyl-5-methylimidazolidine-2,4-dione; (5S)-5-cyclohexyl-5-methylimidazolidine-2,4-dione |
| Moleküler Formülü |
C10H16N2O2 |
| Molekül Ağırlığı |
196.2462 |
| InChI |
InChI=1/C10H16N2O2/c1-10(7-5-3-2-4-6-7)8(13)11-9(14)12-10/h7H,2-6H2,1H3,(H2,11,12,13,14)/t10-/m0/s1 |
| CAS kayıt numarası |
6843-49-8 |
| EINECS |
229-928-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.138g/cm3 |
| Ergime noktası |
199-201℃ |
| Kırılma indisi |
1.505 |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
