ChemNet > CAS > 6937-16-2 ethyl 4-aminobutyrate hydrochloride
6937-16-2 ethyl 4-aminobutyrate hydrochloride
| Ürün Adı |
ethyl 4-aminobutyrate hydrochloride |
| Eş anlamlı |
4-aminobutyrate ethyl hydrochloride; 4-Aminobutyric acid ethyl ester hydrochloride; Ethyl4-aminobutyratehydrochloride,(4-Aminobutyricacidethylesterhydrochloride); 4-ethoxy-4-oxobutan-1-aminium chloride; ethyl 4-aminobutanoate |
| Moleküler Formülü |
C6H13NO2 |
| Molekül Ağırlığı |
131.1729 |
| InChI |
InChI=1/C6H13NO2/c1-2-9-6(8)4-3-5-7/h2-5,7H2,1H3 |
| CAS kayıt numarası |
6937-16-2 |
| EINECS |
230-063-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.973g/cm3 |
| Ergime noktası |
89-91℃ |
| Kaynama noktası |
182.1°C at 760 mmHg |
| Kırılma indisi |
1.434 |
| Alevlenme noktası |
54.5°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
