ChemNet > CAS > 69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
Ürün Adı |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
Eş anlamlı |
Methyl 2,5-dimethylpyrrole-3-carboxylate |
Moleküler Formülü |
C8H11NO2 |
Molekül Ağırlığı |
153.1784 |
InChI |
InChI=1/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 |
CAS kayıt numarası |
69687-80-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.108g/cm3 |
Ergime noktası |
115℃ |
Kaynama noktası |
294.3°C at 760 mmHg |
Kırılma indisi |
1.521 |
Alevlenme noktası |
131.8°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|