ChemNet > CAS > 69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
| Ürün Adı |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Eş anlamlı |
Methyl 2,5-dimethylpyrrole-3-carboxylate |
| Moleküler Formülü |
C8H11NO2 |
| Molekül Ağırlığı |
153.1784 |
| InChI |
InChI=1/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 |
| CAS kayıt numarası |
69687-80-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.108g/cm3 |
| Ergime noktası |
115℃ |
| Kaynama noktası |
294.3°C at 760 mmHg |
| Kırılma indisi |
1.521 |
| Alevlenme noktası |
131.8°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
