ChemNet > CAS > 697-86-9 2-Bromo-4,6-dichloroaniline
697-86-9 2-Bromo-4,6-dichloroaniline
| Ürün Adı |
2-Bromo-4,6-dichloroaniline |
| Eş anlamlı |
2-bromo-1-(4-cyclohexylphenyl)ethanone; Benzenamine, 2-bromo-4,6-dichloro- |
| Moleküler Formülü |
C6H4BrCl2N |
| Molekül Ağırlığı |
240.9127 |
| InChI |
InChI=1/C6H4BrCl2N/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,10H2 |
| CAS kayıt numarası |
697-86-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.827g/cm3 |
| Kaynama noktası |
273°C at 760 mmHg |
| Kırılma indisi |
1.648 |
| Alevlenme noktası |
121.8°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
