ChemNet > CAS > 703-23-1 2-Hydroxy-6-methoxyacetophenone
703-23-1 2-Hydroxy-6-methoxyacetophenone
| Ürün Adı |
2-Hydroxy-6-methoxyacetophenone |
| Eş anlamlı |
1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one; 1-(2-hydroxy-6-methoxyphenyl)ethanone; 2'-Hydroxy-6'-methoxyacetophenone |
| Moleküler Formülü |
C9H10O3 |
| Molekül Ağırlığı |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
| CAS kayıt numarası |
703-23-1 |
| EINECS |
211-872-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.158g/cm3 |
| Ergime noktası |
58-60℃ |
| Kaynama noktası |
259.5°C at 760 mmHg |
| Kırılma indisi |
1.537 |
| Alevlenme noktası |
108.1°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
