ChemNet > CAS > 7152-40-1 5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile
7152-40-1 5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile
| Ürün Adı |
5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile |
| Eş anlamlı |
1H-pyrazole-3-acetonitrile, 5-amino-4-cyano-1-phenyl-; 1H-Pyrazole-4-carbonitrile, 5-amino-3-cyanomethyl-1-phenyl-; 5-Amino-3-cyanomethyl-1-phenyl-1H-pyrazole-4-carbonitrile |
| Moleküler Formülü |
C12H9N5 |
| Molekül Ağırlığı |
223.2334 |
| InChI |
InChI=1/C12H9N5/c13-7-6-11-10(8-14)12(15)17(16-11)9-4-2-1-3-5-9/h1-5H,6,15H2 |
| CAS kayıt numarası |
7152-40-1 |
| EINECS |
230-496-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.27g/cm3 |
| Ergime noktası |
165.5-166.5℃ |
| Kaynama noktası |
486.8°C at 760 mmHg |
| Kırılma indisi |
1.673 |
| Alevlenme noktası |
248.2°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
