ChemNet > CAS > 71642-16-5 3-Methyl-2,4,6-tribromoaniline
71642-16-5 3-Methyl-2,4,6-tribromoaniline
| Ürün Adı |
3-Methyl-2,4,6-tribromoaniline |
| Eş anlamlı |
2,4,6-Tribromo-3-methylaniline~2,4,6-Tribromo-m-toluidine; 2,4,6-Tribromo-m-toluidine; 2,4,6-tribromo-3-methylaniline |
| Moleküler Formülü |
C7H6Br3N |
| Molekül Ağırlığı |
343.8412 |
| InChI |
InChI=1/C7H6Br3N/c1-3-4(8)2-5(9)7(11)6(3)10/h2H,11H2,1H3 |
| CAS kayıt numarası |
71642-16-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
2.196g/cm3 |
| Ergime noktası |
101-102℃ |
| Kaynama noktası |
314.1°C at 760 mmHg |
| Kırılma indisi |
1.668 |
| Alevlenme noktası |
143.8°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
