ChemNet > CAS > 72235-55-3 3-Chloro-2-fluorobenzylamine
72235-55-3 3-Chloro-2-fluorobenzylamine
Ürün Adı |
3-Chloro-2-fluorobenzylamine |
Eş anlamlı |
1-(3-chloro-2-fluorophenyl)methanamine |
Moleküler Formülü |
C7H7ClFN |
Molekül Ağırlığı |
159.5886 |
InChI |
InChI=1/C7H7ClFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2 |
CAS kayıt numarası |
72235-55-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.27g/cm3 |
Kaynama noktası |
219.6°C at 760 mmHg |
Kırılma indisi |
1.543 |
Alevlenme noktası |
86.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|