ChemNet > CAS > 73960-07-3 4-(Difluoromethoxy)benzaldehyde
73960-07-3 4-(Difluoromethoxy)benzaldehyde
Ürün Adı |
4-(Difluoromethoxy)benzaldehyde |
Eş anlamlı |
p-(Difluoromethoxy)benzaldehyde |
Moleküler Formülü |
C8H6F2O2 |
Molekül Ağırlığı |
172.1288 |
InChI |
InChI=1/C8H6F2O2/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-5,8H |
CAS kayıt numarası |
73960-07-3 |
EINECS |
277-653-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.262g/cm3 |
Kaynama noktası |
234.7°C at 760 mmHg |
Kırılma indisi |
1.497 |
Alevlenme noktası |
93.1°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|