ChemNet > CAS > 7429-37-0 trans-1,2-Dibromocyclohexane
7429-37-0 trans-1,2-Dibromocyclohexane
| Ürün Adı |
trans-1,2-Dibromocyclohexane |
| Eş anlamlı |
Dibromocyclohexane; (1S,2S)-1,2-dibromocyclohexane |
| Moleküler Formülü |
C6H10Br2 |
| Molekül Ağırlığı |
241.9516 |
| InChI |
InChI=1/C6H10Br2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6-/m0/s1 |
| CAS kayıt numarası |
7429-37-0 |
| EINECS |
231-070-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.79g/cm3 |
| Kaynama noktası |
220.548°C at 760 mmHg |
| Kırılma indisi |
1.553 |
| Alevlenme noktası |
91.462°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
