ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
| Ürün Adı |
Bromodichloromethane |
| Eş anlamlı |
FC-20B1 |
| Moleküler Formülü |
CHBrCl2 |
| Molekül Ağırlığı |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| CAS kayıt numarası |
75-27-4 |
| EINECS |
200-856-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
2.013g/cm3 |
| Ergime noktası |
-55℃ |
| Kaynama noktası |
89.7°C at 760 mmHg |
| Kırılma indisi |
1.503 |
| Alevlenme noktası |
1.3°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
