ChemNet > CAS > 771-62-0 pentafluorothiophenol
771-62-0 pentafluorothiophenol
| Ürün Adı |
pentafluorothiophenol |
| Eş anlamlı |
Pentafluorobenzenethiol |
| Moleküler Formülü |
C6HF5S |
| Molekül Ağırlığı |
200.12 |
| InChI |
InChI=1/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| CAS kayıt numarası |
771-62-0 |
| EINECS |
212-236-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.5 |
| Ergime noktası |
-24℃ |
| Kaynama noktası |
143℃ |
| Kırılma indisi |
1.463-1.465 |
| Alevlenme noktası |
51℃ |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R10:Flammable.;
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
