ChemNet > CAS > 771-97-1 2,3-Diaminonaphthalene
771-97-1 2,3-Diaminonaphthalene
| Ürün Adı |
2,3-Diaminonaphthalene |
| Eş anlamlı |
2,3-Naphthalenediamine; naphthalene-2,3-diamine |
| Moleküler Formülü |
C10H10N2 |
| Molekül Ağırlığı |
158.1998 |
| InChI |
InChI=1/C10H10N2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H,11-12H2 |
| CAS kayıt numarası |
771-97-1 |
| EINECS |
212-241-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.234g/cm3 |
| Ergime noktası |
193-199℃ |
| Kaynama noktası |
370.6°C at 760 mmHg |
| Kırılma indisi |
1.757 |
| Alevlenme noktası |
212.3°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
