ChemNet > CAS > 81067-38-1 1-Bromo-2,3,5-trichlorobenzene
81067-38-1 1-Bromo-2,3,5-trichlorobenzene
| Ürün Adı |
1-Bromo-2,3,5-trichlorobenzene |
| Eş anlamlı |
2,3,5-Trichlorobromobenzene |
| Moleküler Formülü |
C6H2BrCl3 |
| Molekül Ağırlığı |
260.3431 |
| InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
| CAS kayıt numarası |
81067-38-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.84g/cm3 |
| Ergime noktası |
58-61℃ |
| Kaynama noktası |
270.8°C at 760 mmHg |
| Kırılma indisi |
1.603 |
| Alevlenme noktası |
129.3°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
