ChemNet > CAS > 81156-68-5 2,4-Dichlorophenethylalcohol
81156-68-5 2,4-Dichlorophenethylalcohol
Ürün Adı |
2,4-Dichlorophenethylalcohol |
Eş anlamlı |
2-(2,4-Dichlorophenyl)-ethanol; 2,4-dichlorophenethyl alcohol; 2-(2,4-Dichlorophenyl)ethanol |
Moleküler Formülü |
C8H8Cl2O |
Molekül Ağırlığı |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5,11H,3-4H2 |
CAS kayıt numarası |
81156-68-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.329g/cm3 |
Kaynama noktası |
276.6°C at 760 mmHg |
Kırılma indisi |
1.569 |
Alevlenme noktası |
117.2°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|