CAS No: 82632-80-2, Chemical Name: 2,3,6,7,10,11-hexabromotriphenylene
the physical and chemical property of 82632-80-2, 2,3,6,7,10,11-hexabromotriphenylene is provided by ChemNet.com
ChemNet > CAS > 82632-80-2 2,3,6,7,10,11-hexabromotriphenylene
82632-80-2 2,3,6,7,10,11-hexabromotriphenylene
Ürün Adı |
2,3,6,7,10,11-hexabromotriphenylene |
Eş anlamlı |
triphenylene, 2,3,6,7,10,11-hexabromo- |
Moleküler Formülü |
C18H6Br6 |
Molekül Ağırlığı |
701.6642 |
InChI |
InChI=1/C18H6Br6/c19-13-1-7-8(2-14(13)20)10-4-17(23)18(24)6-12(10)11-5-16(22)15(21)3-9(7)11/h1-6H |
CAS kayıt numarası |
82632-80-2 |
Moleküler Yapısı |
|
Yoğunluk |
2.429g/cm3 |
Kaynama noktası |
689.788°C at 760 mmHg |
Kırılma indisi |
1.822 |
Alevlenme noktası |
354.305°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
|
|