ChemNet > CAS > 84282-78-0 3-chloro-4-fluorophenylhydrazine
84282-78-0 3-chloro-4-fluorophenylhydrazine
| Ürün Adı |
3-chloro-4-fluorophenylhydrazine |
| Moleküler Formülü |
C6H6ClFN2 |
| Molekül Ağırlığı |
160.5766 |
| InChI |
InChI=1/C6H6ClFN2/c7-5-3-4(10-9)1-2-6(5)8/h1-3,10H,9H2 |
| CAS kayıt numarası |
84282-78-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.43g/cm3 |
| Ergime noktası |
62-63℃ |
| Kaynama noktası |
253.1°C at 760 mmHg |
| Kırılma indisi |
1.624 |
| Alevlenme noktası |
106.9°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
