ChemNet > CAS > 84282-78-0 3-chloro-4-fluorophenylhydrazine
84282-78-0 3-chloro-4-fluorophenylhydrazine
Ürün Adı |
3-chloro-4-fluorophenylhydrazine |
Moleküler Formülü |
C6H6ClFN2 |
Molekül Ağırlığı |
160.5766 |
InChI |
InChI=1/C6H6ClFN2/c7-5-3-4(10-9)1-2-6(5)8/h1-3,10H,9H2 |
CAS kayıt numarası |
84282-78-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.43g/cm3 |
Ergime noktası |
62-63℃ |
Kaynama noktası |
253.1°C at 760 mmHg |
Kırılma indisi |
1.624 |
Alevlenme noktası |
106.9°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|