ChemNet > CAS > 84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
Ürün Adı |
4-Dimethylamino-2-methoxybenzaldehyde |
Moleküler Formülü |
C10H13NO2 |
Molekül Ağırlığı |
179.2157 |
InChI |
InChI=1/C10H13NO2/c1-11(2)9-5-4-8(7-12)10(6-9)13-3/h4-7H,1-3H3 |
CAS kayıt numarası |
84562-48-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.098g/cm3 |
Ergime noktası |
59-60℃ |
Kaynama noktası |
305.9°C at 760 mmHg |
Kırılma indisi |
1.576 |
Alevlenme noktası |
138.8°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|