ChemNet > CAS > 865-49-6 Chloroform-d
865-49-6 Chloroform-d
| Ürün Adı |
Chloroform-d |
| Eş anlamlı |
Chloroform-d+1% TMs (v/v); chloroform-D 99.8 atom % D*contains 1% tms; Chloroformdisotopicpuritytetramethylsilane; Chloroform-d + 0.05% TMS (v/v); Chloroformdiosotopicpurity; Chloroform D1; trichloro(~2~H)methane |
| Moleküler Formülü |
CDCl3 |
| Molekül Ağırlığı |
120.3838 |
| InChI |
InChI=1/CHCl3/c2-1(3)4/h1H/i1D |
| CAS kayıt numarası |
865-49-6 |
| EINECS |
212-742-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.512g/cm3 |
| Ergime noktası |
-64℃ |
| Kaynama noktası |
61.2°C at 760 mmHg |
| Kırılma indisi |
1.445 |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R22:Harmful if swallowed.;
R38:Irritating to skin.;
R40:Possible risks of irreversible effects.;
R48/20/22:Harmful : danger of serious damage to health by prolonged exposure through inhalation and if swallowed.;
|
| Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|
