ChemNet > CAS > 868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
868-54-2 2-Amino-1-propene-1,1,3-tricarbonitrile
Ürün Adı |
2-Amino-1-propene-1,1,3-tricarbonitrile |
Eş anlamlı |
2-aminoprop-1-ene-1,1,3-tricarbonitrile |
Moleküler Formülü |
C6H4N4 |
Molekül Ağırlığı |
132.1228 |
InChI |
InChI=1/C6H4N4/c7-2-1-6(10)5(3-8)4-9/h5,10H,1H2/b10-6+ |
CAS kayıt numarası |
868-54-2 |
EINECS |
212-777-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.13g/cm3 |
Ergime noktası |
171-173℃ |
Kaynama noktası |
454.9°C at 760 mmHg |
Kırılma indisi |
1.565 |
Alevlenme noktası |
228.9°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
|
|