ChemNet > CAS > 89581-82-8 2-Acetyl-3-chlorothiophene
89581-82-8 2-Acetyl-3-chlorothiophene
Ürün Adı |
2-Acetyl-3-chlorothiophene |
Eş anlamlı |
1-(3-chlorothiophen-2-yl)ethanone |
Moleküler Formülü |
C6H5ClOS |
Molekül Ağırlığı |
160.6213 |
InChI |
InChI=1/C6H5ClOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
CAS kayıt numarası |
89581-82-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.312g/cm3 |
Kaynama noktası |
219.9°C at 760 mmHg |
Kırılma indisi |
1.559 |
Alevlenme noktası |
86.8°C |
Tehlike Sembolleri |
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|