ChemNet > CAS > 89581-82-8 2-Acetyl-3-chlorothiophene
89581-82-8 2-Acetyl-3-chlorothiophene
| Ürün Adı |
2-Acetyl-3-chlorothiophene |
| Eş anlamlı |
1-(3-chlorothiophen-2-yl)ethanone |
| Moleküler Formülü |
C6H5ClOS |
| Molekül Ağırlığı |
160.6213 |
| InChI |
InChI=1/C6H5ClOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
| CAS kayıt numarası |
89581-82-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.312g/cm3 |
| Kaynama noktası |
219.9°C at 760 mmHg |
| Kırılma indisi |
1.559 |
| Alevlenme noktası |
86.8°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
