ChemNet > CAS > 89787-12-2 (2-Isopropylphenyl)boronic acid
89787-12-2 (2-Isopropylphenyl)boronic acid
Ürün Adı |
(2-Isopropylphenyl)boronic acid |
Eş anlamlı |
2-Isopropylbenzeneboronic acid; 2-Cumylboronic acid~2-Isopropylphenylboronic acid; [2-(1-methylethyl)phenyl]boronic acid; 2-Isopropylphenylboronic Acid |
Moleküler Formülü |
C9H13BO2 |
Molekül Ağırlığı |
164.0093 |
InChI |
InChI=1/C9H13BO2/c1-7(2)8-5-3-4-6-9(8)10(11)12/h3-7,11-12H,1-2H3 |
CAS kayıt numarası |
89787-12-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.04g/cm3 |
Kaynama noktası |
297.2°C at 760 mmHg |
Kırılma indisi |
1.513 |
Alevlenme noktası |
133.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|