ChemNet > CAS > 89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
89793-11-3 Methyl-2-chloro-6-methylpyrimidine-4-carboxylate
| Ürün Adı |
Methyl-2-chloro-6-methylpyrimidine-4-carboxylate |
| Eş anlamlı |
Methyl 2-chloro-6-methylpyrimidine-4-carboxylate |
| Moleküler Formülü |
C7H7ClN2O2 |
| Molekül Ağırlığı |
186.5957 |
| InChI |
InChI=1/C7H7ClN2O2/c1-4-3-5(6(11)12-2)10-7(8)9-4/h3H,1-2H3 |
| CAS kayıt numarası |
89793-11-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.314g/cm3 |
| Ergime noktası |
107℃ |
| Kaynama noktası |
306.5°C at 760 mmHg |
| Kırılma indisi |
1.53 |
| Alevlenme noktası |
139.2°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
