ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
Ürün Adı |
poly(chlorotrifluoroethylene) |
Eş anlamlı |
halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
Moleküler Formülü |
C2ClF3 |
Molekül Ağırlığı |
116.4693 |
InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
CAS kayıt numarası |
9002-83-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.9 |
Ergime noktası |
210℃ |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|