ChemNet > CAS > 91182-77-3 3-methyl-5-phenyl-4-isoxazolecarbonyl chloride
91182-77-3 3-methyl-5-phenyl-4-isoxazolecarbonyl chloride
| Ürün Adı |
3-methyl-5-phenyl-4-isoxazolecarbonyl chloride |
| Eş anlamlı |
3-methyl-5-phenylisoxazole-4-carbonyl chloride |
| Moleküler Formülü |
C11H8ClNO2 |
| Molekül Ağırlığı |
221.6397 |
| InChI |
InChI=1/C11H8ClNO2/c1-7-9(11(12)14)10(15-13-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| CAS kayıt numarası |
91182-77-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.278g/cm3 |
| Kaynama noktası |
369.1°C at 760 mmHg |
| Kırılma indisi |
1.562 |
| Alevlenme noktası |
177°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
