ChemNet > CAS > 93041-45-3 3-(4-methoxyphenyl)-5-methyl-4-isoxazolecarboxylic acid
93041-45-3 3-(4-methoxyphenyl)-5-methyl-4-isoxazolecarboxylic acid
| Ürün Adı |
3-(4-methoxyphenyl)-5-methyl-4-isoxazolecarboxylic acid |
| Eş anlamlı |
3-(4-methoxyphenyl)-5-methylisoxazole-4-carboxylic acid |
| Moleküler Formülü |
C12H11NO4 |
| Molekül Ağırlığı |
233.22 |
| InChI |
InChI=1/C12H11NO4/c1-7-10(12(14)15)11(13-17-7)8-3-5-9(16-2)6-4-8/h3-6H,1-2H3,(H,14,15) |
| CAS kayıt numarası |
93041-45-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.27g/cm3 |
| Ergime noktası |
191℃ |
| Kaynama noktası |
399.1°C at 760 mmHg |
| Kırılma indisi |
1.563 |
| Alevlenme noktası |
195.2°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
