ChemNet > CAS > 933-78-8 2,3,5-Trichlorophenol
933-78-8 2,3,5-Trichlorophenol
| Ürün Adı |
2,3,5-Trichlorophenol |
| Moleküler Formülü |
C6H3Cl3O |
| Molekül Ağırlığı |
197.4464 |
| InChI |
InChI=1/C6H3Cl3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
| CAS kayıt numarası |
933-78-8 |
| EINECS |
213-272-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.596g/cm3 |
| Ergime noktası |
57-60℃ |
| Kaynama noktası |
250.2°C at 760 mmHg |
| Kırılma indisi |
1.608 |
| Alevlenme noktası |
105.1°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
