ChemNet > CAS > 933-78-8 2,3,5-Trichlorophenol
933-78-8 2,3,5-Trichlorophenol
Ürün Adı |
2,3,5-Trichlorophenol |
Moleküler Formülü |
C6H3Cl3O |
Molekül Ağırlığı |
197.4464 |
InChI |
InChI=1/C6H3Cl3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
CAS kayıt numarası |
933-78-8 |
EINECS |
213-272-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.596g/cm3 |
Ergime noktası |
57-60℃ |
Kaynama noktası |
250.2°C at 760 mmHg |
Kırılma indisi |
1.608 |
Alevlenme noktası |
105.1°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|