ChemNet > CAS > 99-20-7 D-Trehalose anhydrous
99-20-7 D-Trehalose anhydrous
| Ürün Adı |
D-Trehalose anhydrous |
| Eş anlamlı |
Trehalose; alpha-D-Trehalose; alpha-D-glucopyranosyl alpha-D-glucopyranoside; Trehalose; D(+)Trehalose; D-(+)-Trehalose; α-L-glucopyranosyl; α-D-glucopyranoside; Trehalose anhydrous |
| Moleküler Formülü |
C12H22O11 |
| Molekül Ağırlığı |
342.2965 |
| InChI |
InChI=1/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| CAS kayıt numarası |
99-20-7 |
| EINECS |
202-739-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.76g/cm3 |
| Ergime noktası |
214-216℃ |
| Kaynama noktası |
675.4°C at 760 mmHg |
| Kırılma indisi |
1.652 |
| Alevlenme noktası |
362.3°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
