Details for 4-Bromomethylphenylboronic acid

4-Bromomethylphenylboronic acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
68162-47-0 |
| EC NO: |
|
| Molecular Formula: |
C7H8BBrO2 |
| Molecular Weight: |
214.8522 |
| Specification: |
|
| InChI: |
InChI=1/C7H8BBrO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5H2 |
| Synonyms: |
4-Bromomethylphenylboronic acid tech.;4-(Bromomethyl)benzeneboronic acid;4-Boronobenzyl bromide;4-(Bromomethyl)phenylboronic acid;P-(BROMOMETHYL)PHENYLBORONIC ACID;4-Bromomethylphenylboronic acid;
|
| Molecular Structure: |
 |
if you are sourcing 4-Bromomethylphenylboronic acid from Australia ,just feel free to inquire